C37H34N4O4 — CID 71761432
4-(1,5-dibenzyl-2-oxo-3-pyridinyl)-1-[4-(4-pyrrol-1-ylphenyl)piperazin-1-yl]butane-1,2,4-trione (PubChem CID 71761432) has the molecular formula C37H34N4O4 and a molecular weight of 598.70 g/mol. Its IUPAC name is 4-(1,5-dibenzyl-2-oxo-3-pyridinyl)-1-[4-(4-pyrrol-1-ylphenyl)piperazin-1-yl]butane-1,2,4-trione.
| Compound Name | 4-(1,5-dibenzyl-2-oxo-3-pyridinyl)-1-[4-(4-pyrrol-1-ylphenyl)piperazin-1-yl]butane-1,2,4-trione |
|---|---|
| PubChem CID | 71761432 |
| Molecular Formula | C37H34N4O4 |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.26 |
| IUPAC Name | 4-(1,5-dibenzyl-2-oxo-3-pyridinyl)-1-[4-(4-pyrrol-1-ylphenyl)piperazin-1-yl]butane-1,2,4-trione |
| SMILES | O=C(CC(=O)c1cc(Cc2ccccc2)cn(Cc2ccccc2)c1=O)C(=O)N1CCN(c2ccc(-n3cccc3)cc2)CC1 |
| InChI | InChI=1S/C37H34N4O4/c42-34(33-24-30(23-28-9-3-1-4-10-28)27-41(36(33)44)26-29-11-5-2-6-12-29)25-35(43)37(45)40-21-19-39(20-22-40)32-15-13-31(14-16-32)38-17-7-8-18-38/h1-18,24,27H,19-23,25-26H2 |
| InChIKey | QVAQHYGNFURGQB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 84.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|