C35H32F4N4O4 — CID 71761189
1-[4-[4-(dimethylamino)phenyl]piperazin-1-yl]-4-[1-[(2-fluorophenyl)methyl]-2-oxo-5-[(2,4,6-trifluorophenyl)methyl]-3-pyridinyl]butane-1,2,4-trione (PubChem CID 71761189) has the molecular formula C35H32F4N4O4 and a molecular weight of 648.66 g/mol. Its IUPAC name is 1-[4-[4-(dimethylamino)phenyl]piperazin-1-yl]-4-[1-[(2-fluorophenyl)methyl]-2-oxo-5-[(2,4,6-trifluorophenyl)methyl]-3-pyridinyl]butane-1,2,4-trione.
| Compound Name | 1-[4-[4-(dimethylamino)phenyl]piperazin-1-yl]-4-[1-[(2-fluorophenyl)methyl]-2-oxo-5-[(2,4,6-trifluorophenyl)methyl]-3-pyridinyl]butane-1,2,4-trione |
|---|---|
| PubChem CID | 71761189 |
| Molecular Formula | C35H32F4N4O4 |
| Molecular Weight | 648.66 g/mol |
| Exact Mass | 648.24 |
| IUPAC Name | 1-[4-[4-(dimethylamino)phenyl]piperazin-1-yl]-4-[1-[(2-fluorophenyl)methyl]-2-oxo-5-[(2,4,6-trifluorophenyl)methyl]-3-pyridinyl]butane-1,2,4-trione |
| SMILES | CN(C)c1ccc(N2CCN(C(=O)C(=O)CC(=O)c3cc(Cc4c(F)cc(F)cc4F)cn(Cc4ccccc4F)c3=O)CC2)cc1 |
| InChI | InChI=1S/C35H32F4N4O4/c1-40(2)25-7-9-26(10-8-25)41-11-13-42(14-12-41)35(47)33(45)19-32(44)28-16-22(15-27-30(38)17-24(36)18-31(27)39)20-43(34(28)46)21-23-5-3-4-6-29(23)37/h3-10,16-18,20H,11-15,19,21H2,1-2H3 |
| InChIKey | YZHMXMDXXRCVBA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 82.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.66 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|