C35H34F2N4O4 — CID 71761535
1-[4-[4-(dimethylamino)phenyl]piperazin-1-yl]-4-[1-[(2-fluorophenyl)methyl]-5-[(4-fluorophenyl)methyl]-2-oxo-3-pyridinyl]butane-1,2,4-trione (PubChem CID 71761535) has the molecular formula C35H34F2N4O4 and a molecular weight of 612.68 g/mol. Its IUPAC name is 1-[4-[4-(dimethylamino)phenyl]piperazin-1-yl]-4-[1-[(2-fluorophenyl)methyl]-5-[(4-fluorophenyl)methyl]-2-oxo-3-pyridinyl]butane-1,2,4-trione.
| Compound Name | 1-[4-[4-(dimethylamino)phenyl]piperazin-1-yl]-4-[1-[(2-fluorophenyl)methyl]-5-[(4-fluorophenyl)methyl]-2-oxo-3-pyridinyl]butane-1,2,4-trione |
|---|---|
| PubChem CID | 71761535 |
| Molecular Formula | C35H34F2N4O4 |
| Molecular Weight | 612.68 g/mol |
| Exact Mass | 612.25 |
| IUPAC Name | 1-[4-[4-(dimethylamino)phenyl]piperazin-1-yl]-4-[1-[(2-fluorophenyl)methyl]-5-[(4-fluorophenyl)methyl]-2-oxo-3-pyridinyl]butane-1,2,4-trione |
| SMILES | CN(C)c1ccc(N2CCN(C(=O)C(=O)CC(=O)c3cc(Cc4ccc(F)cc4)cn(Cc4ccccc4F)c3=O)CC2)cc1 |
| InChI | InChI=1S/C35H34F2N4O4/c1-38(2)28-11-13-29(14-12-28)39-15-17-40(18-16-39)35(45)33(43)21-32(42)30-20-25(19-24-7-9-27(36)10-8-24)22-41(34(30)44)23-26-5-3-4-6-31(26)37/h3-14,20,22H,15-19,21,23H2,1-2H3 |
| InChIKey | PTNMHWAHMFYHCB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 82.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.68 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|