C16H15Cl2NO2 — CID 11878188
(5S,9R,16S)-3,3-dichloro-9-methyl-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-10,12,14-triene-2,4-dione (PubChem CID 11878188) has the molecular formula C16H15Cl2NO2 and a molecular weight of 324.21 g/mol. Its IUPAC name is (5S,9R,16S)-3,3-dichloro-9-methyl-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-10,12,14-triene-2,4-dione.
| Compound Name | (5S,9R,16S)-3,3-dichloro-9-methyl-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-10,12,14-triene-2,4-dione |
|---|---|
| PubChem CID | 11878188 |
| Molecular Formula | C16H15Cl2NO2 |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | (5S,9R,16S)-3,3-dichloro-9-methyl-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-10,12,14-triene-2,4-dione |
| SMILES | C[C@@]12CCC[C@@H]3C(=O)C(Cl)(Cl)C(=O)N(c4ccccc41)[C@@H]32 |
| InChI | InChI=1S/C16H15Cl2NO2/c1-15-8-4-5-9-12(15)19(11-7-3-2-6-10(11)15)14(21)16(17,18)13(9)20/h2-3,6-7,9,12H,4-5,8H2,1H3/t9-,12-,15+/m0/s1 |
| InChIKey | JPYUXOAHWUWNMR-ONENECBXSA-N |
| XLogP | 3.22 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|