C22H23N5O4 — CID 118865376
1-(3-amino-4-methylphenyl)-3-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-1-yl]methyl]urea (PubChem CID 118865376) has the molecular formula C22H23N5O4 and a molecular weight of 421.46 g/mol. Its IUPAC name is 1-(3-amino-4-methylphenyl)-3-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-1-yl]methyl]urea.
| Compound Name | 1-(3-amino-4-methylphenyl)-3-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-1-yl]methyl]urea |
|---|---|
| PubChem CID | 118865376 |
| Molecular Formula | C22H23N5O4 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 1-(3-amino-4-methylphenyl)-3-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-1-yl]methyl]urea |
| SMILES | Cc1ccc(NC(=O)NCC2c3ccccc3C(=O)N2C2CCC(=O)NC2=O)cc1N |
| InChI | InChI=1S/C22H23N5O4/c1-12-6-7-13(10-16(12)23)25-22(31)24-11-18-14-4-2-3-5-15(14)21(30)27(18)17-8-9-19(28)26-20(17)29/h2-7,10,17-18H,8-9,11,23H2,1H3,(H2,24,25,31)(H,26,28,29) |
| InChIKey | HBQRPFVNEHYUSK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 133.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|