C28H40O9 — CID 118922995
[(1R,2S,4S,9S,10S,14S,15R,16R,17R,18S,20R)-10,15,17-trihydroxy-7,7,12,16,19,19-hexamethyl-11-oxo-3,6,8-trioxahexacyclo[13.5.0.02,4.04,9.010,14.018,20]icos-12-en-18-yl] 2-methylbutanoate (PubChem CID 118922995) has the molecular formula C28H40O9 and a molecular weight of 520.62 g/mol. Its IUPAC name is [(1R,2S,4S,9S,10S,14S,15R,16R,17R,18S,20R)-10,15,17-trihydroxy-7,7,12,16,19,19-hexamethyl-11-oxo-3,6,8-trioxahexacyclo[13.5.0.02,4.04,9.010,14.018,20]icos-12-en-18-yl] 2-methylbutanoate.
| Compound Name | [(1R,2S,4S,9S,10S,14S,15R,16R,17R,18S,20R)-10,15,17-trihydroxy-7,7,12,16,19,19-hexamethyl-11-oxo-3,6,8-trioxahexacyclo[13.5.0.02,4.04,9.010,14.018,20]icos-12-en-18-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 118922995 |
| Molecular Formula | C28H40O9 |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | [(1R,2S,4S,9S,10S,14S,15R,16R,17R,18S,20R)-10,15,17-trihydroxy-7,7,12,16,19,19-hexamethyl-11-oxo-3,6,8-trioxahexacyclo[13.5.0.02,4.04,9.010,14.018,20]icos-12-en-18-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)O[C@@]12[C@H](O)[C@@H](C)[C@@]3(O)[C@H]([C@@H]1C2(C)C)[C@@H]1O[C@@]12COC(C)(C)O[C@H]2[C@]1(O)C(=O)C(C)=C[C@H]13 |
| InChI | InChI=1S/C28H40O9/c1-9-12(2)21(31)36-28-17(23(28,5)6)16-20-25(35-20)11-34-24(7,8)37-22(25)27(33)15(10-13(3)18(27)29)26(16,32)14(4)19(28)30/h10,12,14-17,19-20,22,30,32-33H,9,11H2,1-8H3/t12?,14-,15+,16-,17-,19-,20+,22-,25+,26+,27-,28-/m1/s1 |
| InChIKey | YQYLHHWIKGHFCY-AQHGINQDSA-N |
| XLogP | 1.51 |
| TPSA | 135.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|