C19H21F2NO3 — CID 118934419
ethynyl (2S)-3-(3,5-difluorophenyl)-2-[[(E)-5-methylhept-2-enoyl]amino]propanoate (PubChem CID 118934419) has the molecular formula C19H21F2NO3 and a molecular weight of 349.38 g/mol. Its IUPAC name is ethynyl (2S)-3-(3,5-difluorophenyl)-2-[[(E)-5-methylhept-2-enoyl]amino]propanoate.
| Compound Name | ethynyl (2S)-3-(3,5-difluorophenyl)-2-[[(E)-5-methylhept-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 118934419 |
| Molecular Formula | C19H21F2NO3 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | ethynyl (2S)-3-(3,5-difluorophenyl)-2-[[(E)-5-methylhept-2-enoyl]amino]propanoate |
| SMILES | C#COC(=O)[C@H](Cc1cc(F)cc(F)c1)NC(=O)/C=C/CC(C)CC |
| InChI | InChI=1S/C19H21F2NO3/c1-4-13(3)7-6-8-18(23)22-17(19(24)25-5-2)11-14-9-15(20)12-16(21)10-14/h2,6,8-10,12-13,17H,4,7,11H2,1,3H3,(H,22,23)/b8-6+/t13?,17-/m0/s1 |
| InChIKey | MYHBIOLZNDHHAY-HSKALLJASA-N |
| XLogP | 3.12 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|