C23H29ClO6 — CID 118935541
[(1S)-1-chloro-1-[4-[2-[4-[(2S)-2,3-dihydroxypropoxy]phenyl]propan-2-yl]phenoxy]propan-2-yl] acetate (PubChem CID 118935541) has the molecular formula C23H29ClO6 and a molecular weight of 436.93 g/mol. Its IUPAC name is [(1S)-1-chloro-1-[4-[2-[4-[(2S)-2,3-dihydroxypropoxy]phenyl]propan-2-yl]phenoxy]propan-2-yl] acetate.
| Compound Name | [(1S)-1-chloro-1-[4-[2-[4-[(2S)-2,3-dihydroxypropoxy]phenyl]propan-2-yl]phenoxy]propan-2-yl] acetate |
|---|---|
| PubChem CID | 118935541 |
| Molecular Formula | C23H29ClO6 |
| Molecular Weight | 436.93 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | [(1S)-1-chloro-1-[4-[2-[4-[(2S)-2,3-dihydroxypropoxy]phenyl]propan-2-yl]phenoxy]propan-2-yl] acetate |
| SMILES | CC(=O)OC(C)[C@H](Cl)Oc1ccc(C(C)(C)c2ccc(OC[C@@H](O)CO)cc2)cc1 |
| InChI | InChI=1S/C23H29ClO6/c1-15(29-16(2)26)22(24)30-21-11-7-18(8-12-21)23(3,4)17-5-9-20(10-6-17)28-14-19(27)13-25/h5-12,15,19,22,25,27H,13-14H2,1-4H3/t15?,19-,22+/m0/s1 |
| InChIKey | OPDGSAYRUDKRRX-ORDHDVHWSA-N |
| XLogP | 3.64 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.93 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|