C16H18ClN5O — CID 118979509
4-chloro-N-[4-(7-oxa-2-azaspiro[3.5]nonan-2-yl)phenyl]-1,3,5-triazin-2-amine (PubChem CID 118979509) has the molecular formula C16H18ClN5O and a molecular weight of 331.81 g/mol. Its IUPAC name is 4-chloro-N-[4-(7-oxa-2-azaspiro[3.5]nonan-2-yl)phenyl]-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N-[4-(7-oxa-2-azaspiro[3.5]nonan-2-yl)phenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 118979509 |
| Molecular Formula | C16H18ClN5O |
| Molecular Weight | 331.81 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 4-chloro-N-[4-(7-oxa-2-azaspiro[3.5]nonan-2-yl)phenyl]-1,3,5-triazin-2-amine |
| SMILES | Clc1ncnc(Nc2ccc(N3CC4(CCOCC4)C3)cc2)n1 |
| InChI | InChI=1S/C16H18ClN5O/c17-14-18-11-19-15(21-14)20-12-1-3-13(4-2-12)22-9-16(10-22)5-7-23-8-6-16/h1-4,11H,5-10H2,(H,18,19,20,21) |
| InChIKey | ZSZYAXVYFARDAC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.81 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|