C15H21F2NS — CID 119038107
1-[(3,3-difluorocyclohexyl)methyl]-2-thiophen-2-ylpyrrolidine (PubChem CID 119038107) has the molecular formula C15H21F2NS and a molecular weight of 285.40 g/mol. Its IUPAC name is 1-[(3,3-difluorocyclohexyl)methyl]-2-thiophen-2-ylpyrrolidine.
| Compound Name | 1-[(3,3-difluorocyclohexyl)methyl]-2-thiophen-2-ylpyrrolidine |
|---|---|
| PubChem CID | 119038107 |
| Molecular Formula | C15H21F2NS |
| Molecular Weight | 285.40 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 1-[(3,3-difluorocyclohexyl)methyl]-2-thiophen-2-ylpyrrolidine |
| SMILES | FC1(F)CCCC(CN2CCCC2c2cccs2)C1 |
| InChI | InChI=1S/C15H21F2NS/c16-15(17)7-1-4-12(10-15)11-18-8-2-5-13(18)14-6-3-9-19-14/h3,6,9,12-13H,1-2,4-5,7-8,10-11H2 |
| InChIKey | RYWSXYRQEOLIOV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.40 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |