About copper(1+);3-methoxybenzenethiolate
copper(1+);3-methoxybenzenethiolate (PubChem CID 119092830) has the molecular formula C7H7CuOS
and a molecular weight of 202.75 g/mol. Its IUPAC name is copper(1+);3-methoxybenzenethiolate.
Molecular Properties
| Compound Name | copper(1+);3-methoxybenzenethiolate |
| PubChem CID | 119092830 |
| Molecular Formula | C7H7CuOS |
| Molecular Weight | 202.75 g/mol |
| Exact Mass | 201.95 |
| IUPAC Name | copper(1+);3-methoxybenzenethiolate |
| SMILES | COc1cccc([S-])c1.[Cu+] |
| InChI | InChI=1S/C7H8OS.Cu/c1-8-6-3-2-4-7(9)5-6;/h2-5,9H,1H3;/q;+1/p-1 |
| InChIKey | XLVFDRZEMUSCAO-UHFFFAOYSA-M |
| XLogP | 1.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.75 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze copper(1+);3-methoxybenzenethiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper(1+);3-methoxybenzenethiolate?
The IUPAC name of copper(1+);3-methoxybenzenethiolate (CID 119092830) is copper(1+);3-methoxybenzenethiolate.
What is the SMILES notation for copper(1+);3-methoxybenzenethiolate?
The canonical SMILES for copper(1+);3-methoxybenzenethiolate is COc1cccc([S-])c1.[Cu+].
What is the InChIKey of copper(1+);3-methoxybenzenethiolate?
The InChIKey is XLVFDRZEMUSCAO-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8OS.Cu/c1-8-6-3-2-4-7(9)5-6;/h2-5,9H,1H3;/q;+1/p-1.
What are the key properties of copper(1+);3-methoxybenzenethiolate?
copper(1+);3-methoxybenzenethiolate has a molecular weight of 202.75 g/mol, XLogP of 1.60, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper(1+);3-methoxybenzenethiolate is sourced from PubChem (CID 119092830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).