C19H21ClN2S — CID 11914147
(4aS,9bS)-5-(4-chlorophenyl)sulfanyl-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole (PubChem CID 11914147) has the molecular formula C19H21ClN2S and a molecular weight of 344.91 g/mol. Its IUPAC name is (4aS,9bS)-5-(4-chlorophenyl)sulfanyl-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole.
| Compound Name | (4aS,9bS)-5-(4-chlorophenyl)sulfanyl-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 11914147 |
| Molecular Formula | C19H21ClN2S |
| Molecular Weight | 344.91 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | (4aS,9bS)-5-(4-chlorophenyl)sulfanyl-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole |
| SMILES | Cc1ccc2c(c1)[C@H]1CN(C)CC[C@@H]1N2Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H21ClN2S/c1-13-3-8-18-16(11-13)17-12-21(2)10-9-19(17)22(18)23-15-6-4-14(20)5-7-15/h3-8,11,17,19H,9-10,12H2,1-2H3/t17-,19+/m1/s1 |
| InChIKey | MXEIBCYOSABGBK-MJGOQNOKSA-N |
| XLogP | 4.96 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.91 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|