C22H24S — CID 11918891
(4S,4aR,8aS)-4-benzyl-2-phenyl-4a,5,6,7,8,8a-hexahydro-4H-thiochromene (PubChem CID 11918891) has the molecular formula C22H24S and a molecular weight of 320.50 g/mol. Its IUPAC name is (4S,4aR,8aS)-4-benzyl-2-phenyl-4a,5,6,7,8,8a-hexahydro-4H-thiochromene.
| Compound Name | (4S,4aR,8aS)-4-benzyl-2-phenyl-4a,5,6,7,8,8a-hexahydro-4H-thiochromene |
|---|---|
| PubChem CID | 11918891 |
| Molecular Formula | C22H24S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | (4S,4aR,8aS)-4-benzyl-2-phenyl-4a,5,6,7,8,8a-hexahydro-4H-thiochromene |
| SMILES | C1=C(c2ccccc2)S[C@H]2CCCC[C@@H]2[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C22H24S/c1-3-9-17(10-4-1)15-19-16-22(18-11-5-2-6-12-18)23-21-14-8-7-13-20(19)21/h1-6,9-12,16,19-21H,7-8,13-15H2/t19-,20-,21+/m1/s1 |
| InChIKey | DIXNQEVIOOIROG-NJYVYQBISA-N |
| XLogP | 6.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |