C13H18N4O3S — CID 119414823
1,4-diazepan-1-yl-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazin-9-yl)methanone (PubChem CID 119414823) has the molecular formula C13H18N4O3S and a molecular weight of 310.38 g/mol. Its IUPAC name is 1,4-diazepan-1-yl-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazin-9-yl)methanone.
| Compound Name | 1,4-diazepan-1-yl-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazin-9-yl)methanone |
|---|---|
| PubChem CID | 119414823 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 1,4-diazepan-1-yl-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazin-9-yl)methanone |
| SMILES | O=C(C1=CC=CN2CCS(=O)(=O)N=C12)N1CCCNCC1 |
| InChI | InChI=1S/C13H18N4O3S/c18-13(17-7-2-4-14-5-8-17)11-3-1-6-16-9-10-21(19,20)15-12(11)16/h1,3,6,14H,2,4-5,7-10H2 |
| InChIKey | IXGACFHGOIWTGH-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |