C32H32N3O2+ — CID 11946713
(2R,3R,10bS)-3-(adamantane-1-carbonyl)-2-(3-methoxyphenyl)-2,3,4,10b-tetrahydropyrrolo[2,1-a]isoquinolin-4-ium-1,1-dicarbonitrile (PubChem CID 11946713) has the molecular formula C32H32N3O2+ and a molecular weight of 490.63 g/mol. Its IUPAC name is (2R,3R,10bS)-3-(adamantane-1-carbonyl)-2-(3-methoxyphenyl)-2,3,4,10b-tetrahydropyrrolo[2,1-a]isoquinolin-4-ium-1,1-dicarbonitrile.
| Compound Name | (2R,3R,10bS)-3-(adamantane-1-carbonyl)-2-(3-methoxyphenyl)-2,3,4,10b-tetrahydropyrrolo[2,1-a]isoquinolin-4-ium-1,1-dicarbonitrile |
|---|---|
| PubChem CID | 11946713 |
| Molecular Formula | C32H32N3O2+ |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | (2R,3R,10bS)-3-(adamantane-1-carbonyl)-2-(3-methoxyphenyl)-2,3,4,10b-tetrahydropyrrolo[2,1-a]isoquinolin-4-ium-1,1-dicarbonitrile |
| SMILES | COc1cccc([C@H]2[C@H](C(=O)C34CC5CC(CC(C5)C3)C4)[NH+]3C=Cc4ccccc4[C@H]3C2(C#N)C#N)c1 |
| InChI | InChI=1S/C32H31N3O2/c1-37-25-7-4-6-24(14-25)27-28(30(36)31-15-20-11-21(16-31)13-22(12-20)17-31)35-10-9-23-5-2-3-8-26(23)29(35)32(27,18-33)19-34/h2-10,14,20-22,27-29H,11-13,15-17H2,1H3/p+1/t20?,21?,22?,27-,28+,29-,31?/m0/s1 |
| InChIKey | ZTNSWQZMWRWBBY-SOHPDCFESA-O |
| XLogP | 4.59 |
| TPSA | 78.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |