C14H24O5 — CID 11953532
(4R,5S)-5-[(2R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-yl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde (PubChem CID 11953532) has the molecular formula C14H24O5 and a molecular weight of 272.34 g/mol. Its IUPAC name is (4R,5S)-5-[(2R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-yl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde.
| Compound Name | (4R,5S)-5-[(2R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-yl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
|---|---|
| PubChem CID | 11953532 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | (4R,5S)-5-[(2R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-yl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
| SMILES | C[C@H](C[C@@H]1COC(C)(C)O1)[C@@H]1OC(C)(C)O[C@H]1C=O |
| InChI | InChI=1S/C14H24O5/c1-9(6-10-8-16-13(2,3)17-10)12-11(7-15)18-14(4,5)19-12/h7,9-12H,6,8H2,1-5H3/t9-,10-,11+,12+/m1/s1 |
| InChIKey | JXWMUQPVMUNZMP-WYUUTHIRSA-N |
| XLogP | 1.88 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|