C13H16N2O6S — CID 11960355
[(2R,3S,4R,5R)-3,4-dihydroxy-5-indol-1-yloxolan-2-yl]methyl sulfamate (PubChem CID 11960355) has the molecular formula C13H16N2O6S and a molecular weight of 328.35 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-indol-1-yloxolan-2-yl]methyl sulfamate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-indol-1-yloxolan-2-yl]methyl sulfamate |
|---|---|
| PubChem CID | 11960355 |
| Molecular Formula | C13H16N2O6S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-indol-1-yloxolan-2-yl]methyl sulfamate |
| SMILES | NS(=O)(=O)OC[C@H]1O[C@@H](n2ccc3ccccc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H16N2O6S/c14-22(18,19)20-7-10-11(16)12(17)13(21-10)15-6-5-8-3-1-2-4-9(8)15/h1-6,10-13,16-17H,7H2,(H2,14,18,19)/t10-,11-,12-,13-/m1/s1 |
| InChIKey | ARLWPWONUPISHW-FDYHWXHSSA-N |
| XLogP | -0.52 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |