C25H20N6O3 — CID 11962809
4-[[2-[4-[(E)-2-cyanoethenyl]anilino]-7-methyl-5H-pyrrolo[3,2-d]pyrimidin-4-yl]oxy]-3,5-dimethoxybenzonitrile (PubChem CID 11962809) has the molecular formula C25H20N6O3 and a molecular weight of 452.47 g/mol. Its IUPAC name is 4-[[2-[4-[(E)-2-cyanoethenyl]anilino]-7-methyl-5H-pyrrolo[3,2-d]pyrimidin-4-yl]oxy]-3,5-dimethoxybenzonitrile.
| Compound Name | 4-[[2-[4-[(E)-2-cyanoethenyl]anilino]-7-methyl-5H-pyrrolo[3,2-d]pyrimidin-4-yl]oxy]-3,5-dimethoxybenzonitrile |
|---|---|
| PubChem CID | 11962809 |
| Molecular Formula | C25H20N6O3 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 4-[[2-[4-[(E)-2-cyanoethenyl]anilino]-7-methyl-5H-pyrrolo[3,2-d]pyrimidin-4-yl]oxy]-3,5-dimethoxybenzonitrile |
| SMILES | COc1cc(C#N)cc(OC)c1Oc1nc(Nc2ccc(/C=C/C#N)cc2)nc2c(C)c[nH]c12 |
| InChI | InChI=1S/C25H20N6O3/c1-15-14-28-22-21(15)30-25(29-18-8-6-16(7-9-18)5-4-10-26)31-24(22)34-23-19(32-2)11-17(13-27)12-20(23)33-3/h4-9,11-12,14,28H,1-3H3,(H,29,30,31)/b5-4+ |
| InChIKey | ZTQLUOOWYFWGGY-SNAWJCMRSA-N |
| XLogP | 5.23 |
| TPSA | 128.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|