C24H23ClO9 — CID 11983715
2-chloro-1,3,6,8-tetramethoxy-7-[2-(2-methyl-1,3-dioxolan-2-yl)acetyl]anthracene-9,10-dione (PubChem CID 11983715) has the molecular formula C24H23ClO9 and a molecular weight of 490.89 g/mol. Its IUPAC name is 2-chloro-1,3,6,8-tetramethoxy-7-[2-(2-methyl-1,3-dioxolan-2-yl)acetyl]anthracene-9,10-dione.
| Compound Name | 2-chloro-1,3,6,8-tetramethoxy-7-[2-(2-methyl-1,3-dioxolan-2-yl)acetyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 11983715 |
| Molecular Formula | C24H23ClO9 |
| Molecular Weight | 490.89 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | 2-chloro-1,3,6,8-tetramethoxy-7-[2-(2-methyl-1,3-dioxolan-2-yl)acetyl]anthracene-9,10-dione |
| SMILES | COc1cc2c(c(OC)c1Cl)C(=O)c1c(cc(OC)c(C(=O)CC3(C)OCCO3)c1OC)C2=O |
| InChI | InChI=1S/C24H23ClO9/c1-24(33-6-7-34-24)10-13(26)18-14(29-2)8-11-16(22(18)31-4)21(28)17-12(20(11)27)9-15(30-3)19(25)23(17)32-5/h8-9H,6-7,10H2,1-5H3 |
| InChIKey | IWSNEJFTDAXMAD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.89 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|