C33H39O6PS — CID 11992815
[(4R,6S,7R)-7-diphenylphosphanyloxy-2,2-dimethyl-6-(4-methylphenyl)sulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl 2,2-dimethylpropanoate (PubChem CID 11992815) has the molecular formula C33H39O6PS and a molecular weight of 594.71 g/mol. Its IUPAC name is [(4R,6S,7R)-7-diphenylphosphanyloxy-2,2-dimethyl-6-(4-methylphenyl)sulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(4R,6S,7R)-7-diphenylphosphanyloxy-2,2-dimethyl-6-(4-methylphenyl)sulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11992815 |
| Molecular Formula | C33H39O6PS |
| Molecular Weight | 594.71 g/mol |
| Exact Mass | 594.22 |
| IUPAC Name | [(4R,6S,7R)-7-diphenylphosphanyloxy-2,2-dimethyl-6-(4-methylphenyl)sulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl 2,2-dimethylpropanoate |
| SMILES | Cc1ccc(S[C@@H]2O[C@H](COC(=O)C(C)(C)C)C3OC(C)(C)OC3[C@H]2OP(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H39O6PS/c1-22-17-19-25(20-18-22)41-30-29(39-40(23-13-9-7-10-14-23)24-15-11-8-12-16-24)28-27(37-33(5,6)38-28)26(36-30)21-35-31(34)32(2,3)4/h7-20,26-30H,21H2,1-6H3/t26-,27?,28?,29-,30+/m1/s1 |
| InChIKey | KPIIFCSXCDQILE-KARJICKBSA-N |
| XLogP | 6.35 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.71 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|