C30H54Si8 — CID 12058002
tris(2-trimethylsilylethynyl)-[tris(2-trimethylsilylethynyl)silyl]silane (PubChem CID 12058002) has the molecular formula C30H54Si8 and a molecular weight of 639.45 g/mol. Its IUPAC name is tris(2-trimethylsilylethynyl)-[tris(2-trimethylsilylethynyl)silyl]silane.
| Compound Name | tris(2-trimethylsilylethynyl)-[tris(2-trimethylsilylethynyl)silyl]silane |
|---|---|
| PubChem CID | 12058002 |
| Molecular Formula | C30H54Si8 |
| Molecular Weight | 639.45 g/mol |
| Exact Mass | 638.24 |
| IUPAC Name | tris(2-trimethylsilylethynyl)-[tris(2-trimethylsilylethynyl)silyl]silane |
| SMILES | C[Si](C)(C)C#C[Si](C#C[Si](C)(C)C)(C#C[Si](C)(C)C)[Si](C#C[Si](C)(C)C)(C#C[Si](C)(C)C)C#C[Si](C)(C)C |
| InChI | InChI=1S/C30H54Si8/c1-31(2,3)19-25-37(26-20-32(4,5)6,27-21-33(7,8)9)38(28-22-34(10,11)12,29-23-35(13,14)15)30-24-36(16,17)18/h1-18H3 |
| InChIKey | UGRITYQHHAFWMZ-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.45 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|