C21H27ClN4O3 — CID 120587797
2-amino-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]-2-phenylpropanamide;hydrochloride (PubChem CID 120587797) has the molecular formula C21H27ClN4O3 and a molecular weight of 418.93 g/mol. Its IUPAC name is 2-amino-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]-2-phenylpropanamide;hydrochloride.
| Compound Name | 2-amino-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]-2-phenylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 120587797 |
| Molecular Formula | C21H27ClN4O3 |
| Molecular Weight | 418.93 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 2-amino-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]-2-phenylpropanamide;hydrochloride |
| SMILES | CC(N)(C(=O)Nc1ccc(NC(=O)NCC2CCCO2)cc1)c1ccccc1.Cl |
| InChI | InChI=1S/C21H26N4O3.ClH/c1-21(22,15-6-3-2-4-7-15)19(26)24-16-9-11-17(12-10-16)25-20(27)23-14-18-8-5-13-28-18;/h2-4,6-7,9-12,18H,5,8,13-14,22H2,1H3,(H,24,26)(H2,23,25,27);1H |
| InChIKey | FQZAAYIJLHLGDF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.93 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |