C19H14ClNO3S — CID 1206009
3-[(2S)-2-(3-chlorophenyl)-1,3-thiazolidine-3-carbonyl]chromen-2-one (PubChem CID 1206009) has the molecular formula C19H14ClNO3S and a molecular weight of 371.85 g/mol. Its IUPAC name is 3-[(2S)-2-(3-chlorophenyl)-1,3-thiazolidine-3-carbonyl]chromen-2-one.
| Compound Name | 3-[(2S)-2-(3-chlorophenyl)-1,3-thiazolidine-3-carbonyl]chromen-2-one |
|---|---|
| PubChem CID | 1206009 |
| Molecular Formula | C19H14ClNO3S |
| Molecular Weight | 371.85 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 3-[(2S)-2-(3-chlorophenyl)-1,3-thiazolidine-3-carbonyl]chromen-2-one |
| SMILES | O=C(c1cc2ccccc2oc1=O)N1CCS[C@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H14ClNO3S/c20-14-6-3-5-13(10-14)18-21(8-9-25-18)17(22)15-11-12-4-1-2-7-16(12)24-19(15)23/h1-7,10-11,18H,8-9H2/t18-/m0/s1 |
| InChIKey | LRWBFZDVJLAUIY-SFHVURJKSA-N |
| XLogP | 4.33 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.85 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|