C15H23FIN3OS — CID 120661827
N'-[[4-fluoro-2-(methylsulfanylmethyl)phenyl]methyl]-2-methylmorpholine-4-carboximidamide;hydroiodide (PubChem CID 120661827) has the molecular formula C15H23FIN3OS and a molecular weight of 439.34 g/mol. Its IUPAC name is N'-[[4-fluoro-2-(methylsulfanylmethyl)phenyl]methyl]-2-methylmorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[[4-fluoro-2-(methylsulfanylmethyl)phenyl]methyl]-2-methylmorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 120661827 |
| Molecular Formula | C15H23FIN3OS |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | N'-[[4-fluoro-2-(methylsulfanylmethyl)phenyl]methyl]-2-methylmorpholine-4-carboximidamide;hydroiodide |
| SMILES | CSCc1cc(F)ccc1C/N=C(\N)N1CCOC(C)C1.I |
| InChI | InChI=1S/C15H22FN3OS.HI/c1-11-9-19(5-6-20-11)15(17)18-8-12-3-4-14(16)7-13(12)10-21-2;/h3-4,7,11H,5-6,8-10H2,1-2H3,(H2,17,18);1H |
| InChIKey | ZEIWZJFNTFEBTG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|