C15H26ClN5S — CID 120847304
3-[1-(thiolan-3-ylmethyl)piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;hydrochloride (PubChem CID 120847304) has the molecular formula C15H26ClN5S and a molecular weight of 343.93 g/mol. Its IUPAC name is 3-[1-(thiolan-3-ylmethyl)piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;hydrochloride.
| Compound Name | 3-[1-(thiolan-3-ylmethyl)piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;hydrochloride |
|---|---|
| PubChem CID | 120847304 |
| Molecular Formula | C15H26ClN5S |
| Molecular Weight | 343.93 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 3-[1-(thiolan-3-ylmethyl)piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;hydrochloride |
| SMILES | C1Cn2c(nnc2C2CCN(CC3CCSC3)CC2)CN1.Cl |
| InChI | InChI=1S/C15H25N5S.ClH/c1-5-19(10-12-3-8-21-11-12)6-2-13(1)15-18-17-14-9-16-4-7-20(14)15;/h12-13,16H,1-11H2;1H |
| InChIKey | SXJMRKAJEJBJOS-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.93 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |