C14H24IN5OS — CID 120972854
N'-[[(2R,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]methyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 120972854) has the molecular formula C14H24IN5OS and a molecular weight of 437.35 g/mol. Its IUPAC name is N'-[[(2R,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]methyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[[(2R,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]methyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 120972854 |
| Molecular Formula | C14H24IN5OS |
| Molecular Weight | 437.35 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | N'-[[(2R,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]methyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | Cn1nccc1[C@@H]1OCC[C@H]1C/N=C(\N)N1CCSCC1.I |
| InChI | InChI=1S/C14H23N5OS.HI/c1-18-12(2-4-17-18)13-11(3-7-20-13)10-16-14(15)19-5-8-21-9-6-19;/h2,4,11,13H,3,5-10H2,1H3,(H2,15,16);1H/t11-,13+;/m0./s1 |
| InChIKey | HNIFTQIBROLBOB-STEACBGWSA-N |
| XLogP | 1.48 |
| TPSA | 68.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|