C25H29N2S2+ — CID 121284500
2-[3-(3H-1,3-benzothiazol-2-ylidene)prop-1-enyl]-3,4-dibutyl-1,3-benzothiazol-3-ium (PubChem CID 121284500) has the molecular formula C25H29N2S2+ and a molecular weight of 421.66 g/mol. Its IUPAC name is 2-[3-(3H-1,3-benzothiazol-2-ylidene)prop-1-enyl]-3,4-dibutyl-1,3-benzothiazol-3-ium.
| Compound Name | 2-[3-(3H-1,3-benzothiazol-2-ylidene)prop-1-enyl]-3,4-dibutyl-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 121284500 |
| Molecular Formula | C25H29N2S2+ |
| Molecular Weight | 421.66 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 2-[3-(3H-1,3-benzothiazol-2-ylidene)prop-1-enyl]-3,4-dibutyl-1,3-benzothiazol-3-ium |
| SMILES | CCCCc1cccc2sc(C=CC=C3Nc4ccccc4S3)[n+](CCCC)c12 |
| InChI | InChI=1S/C25H28N2S2/c1-3-5-11-19-12-9-15-22-25(19)27(18-6-4-2)24(29-22)17-10-16-23-26-20-13-7-8-14-21(20)28-23/h7-10,12-17H,3-6,11,18H2,1-2H3/p+1 |
| InChIKey | KWPOVOMFZRSLAF-UHFFFAOYSA-O |
| XLogP | 7.40 |
| TPSA | 15.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.66 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|