C18H14ClN2S2+ — CID 173346148
2-[3-(3H-1,3-benzothiazol-2-ylidene)prop-1-enyl]-5-chloro-3-methyl-1,3-benzothiazol-3-ium (PubChem CID 173346148) has the molecular formula C18H14ClN2S2+ and a molecular weight of 357.91 g/mol. Its IUPAC name is 2-[3-(3H-1,3-benzothiazol-2-ylidene)prop-1-enyl]-5-chloro-3-methyl-1,3-benzothiazol-3-ium.
| Compound Name | 2-[3-(3H-1,3-benzothiazol-2-ylidene)prop-1-enyl]-5-chloro-3-methyl-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 173346148 |
| Molecular Formula | C18H14ClN2S2+ |
| Molecular Weight | 357.91 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | 2-[3-(3H-1,3-benzothiazol-2-ylidene)prop-1-enyl]-5-chloro-3-methyl-1,3-benzothiazol-3-ium |
| SMILES | C[n+]1c(C=CC=C2Nc3ccccc3S2)sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C18H13ClN2S2/c1-21-14-11-12(19)9-10-16(14)23-18(21)8-4-7-17-20-13-5-2-3-6-15(13)22-17/h2-11H,1H3/p+1 |
| InChIKey | WYBLDQAOMJDIJV-UHFFFAOYSA-O |
| XLogP | 5.45 |
| TPSA | 15.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.91 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|