C11H10N2OS — CID 131332988
4-(3H-1,3-benzothiazol-2-ylidene)but-2-enamide (PubChem CID 131332988) has the molecular formula C11H10N2OS and a molecular weight of 218.28 g/mol. Its IUPAC name is 4-(3H-1,3-benzothiazol-2-ylidene)but-2-enamide.
| Compound Name | 4-(3H-1,3-benzothiazol-2-ylidene)but-2-enamide |
|---|---|
| PubChem CID | 131332988 |
| Molecular Formula | C11H10N2OS |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 4-(3H-1,3-benzothiazol-2-ylidene)but-2-enamide |
| SMILES | NC(=O)C=CC=C1Nc2ccccc2S1 |
| InChI | InChI=1S/C11H10N2OS/c12-10(14)6-3-7-11-13-8-4-1-2-5-9(8)15-11/h1-7,13H,(H2,12,14) |
| InChIKey | AKNSZUQSAWHBDV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|