C20H19N2OS2+ — CID 87982717
2-[5-(3H-1,3-benzothiazol-2-ylidene)penta-1,3-dienyl]-3-ethyl-5H-pyrano[2,3-d][1,3]thiazol-3-ium (PubChem CID 87982717) has the molecular formula C20H19N2OS2+ and a molecular weight of 367.52 g/mol. Its IUPAC name is 2-[5-(3H-1,3-benzothiazol-2-ylidene)penta-1,3-dienyl]-3-ethyl-5H-pyrano[2,3-d][1,3]thiazol-3-ium.
| Compound Name | 2-[5-(3H-1,3-benzothiazol-2-ylidene)penta-1,3-dienyl]-3-ethyl-5H-pyrano[2,3-d][1,3]thiazol-3-ium |
|---|---|
| PubChem CID | 87982717 |
| Molecular Formula | C20H19N2OS2+ |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 2-[5-(3H-1,3-benzothiazol-2-ylidene)penta-1,3-dienyl]-3-ethyl-5H-pyrano[2,3-d][1,3]thiazol-3-ium |
| SMILES | CC[n+]1c(C=CC=CC=C2Nc3ccccc3S2)sc2c1OCC=C2 |
| InChI | InChI=1S/C20H18N2OS2/c1-2-22-19(25-17-11-8-14-23-20(17)22)13-5-3-4-12-18-21-15-9-6-7-10-16(15)24-18/h3-13H,2,14H2,1H3/p+1 |
| InChIKey | HXIHVXOYEGQCIS-UHFFFAOYSA-O |
| XLogP | 5.09 |
| TPSA | 25.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|