C25H19N4S2+ — CID 142158135
(E)-3-[(2Z)-2-[(E)-3-[6-[(E)-2-cyanoethenyl]-3-methyl-1,3-benzothiazol-3-ium-2-yl]-2-methylprop-2-enylidene]-3H-1,3-benzothiazol-6-yl]prop-2-enenitrile (PubChem CID 142158135) has the molecular formula C25H19N4S2+ and a molecular weight of 439.59 g/mol. Its IUPAC name is (E)-3-[(2Z)-2-[(E)-3-[6-[(E)-2-cyanoethenyl]-3-methyl-1,3-benzothiazol-3-ium-2-yl]-2-methylprop-2-enylidene]-3H-1,3-benzothiazol-6-yl]prop-2-enenitrile.
| Compound Name | (E)-3-[(2Z)-2-[(E)-3-[6-[(E)-2-cyanoethenyl]-3-methyl-1,3-benzothiazol-3-ium-2-yl]-2-methylprop-2-enylidene]-3H-1,3-benzothiazol-6-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 142158135 |
| Molecular Formula | C25H19N4S2+ |
| Molecular Weight | 439.59 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | (E)-3-[(2Z)-2-[(E)-3-[6-[(E)-2-cyanoethenyl]-3-methyl-1,3-benzothiazol-3-ium-2-yl]-2-methylprop-2-enylidene]-3H-1,3-benzothiazol-6-yl]prop-2-enenitrile |
| SMILES | CC(/C=C1/Nc2ccc(/C=C/C#N)cc2S1)=C\c1sc2cc(/C=C/C#N)ccc2[n+]1C |
| InChI | InChI=1S/C25H18N4S2/c1-17(13-24-28-20-9-7-18(5-3-11-26)15-22(20)30-24)14-25-29(2)21-10-8-19(6-4-12-27)16-23(21)31-25/h3-10,13-16H,1-2H3/p+1/b5-3+,6-4+ |
| InChIKey | JXFXOQXMXCWLPH-GGWOSOGESA-O |
| XLogP | 6.26 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.59 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|