C15H24O6 — CID 121324124
[2-ethyl-5-methylperoxy-2-(prop-2-enoyloxymethyl)pentyl] prop-2-enoate (PubChem CID 121324124) has the molecular formula C15H24O6 and a molecular weight of 300.35 g/mol. Its IUPAC name is [2-ethyl-5-methylperoxy-2-(prop-2-enoyloxymethyl)pentyl] prop-2-enoate.
| Compound Name | [2-ethyl-5-methylperoxy-2-(prop-2-enoyloxymethyl)pentyl] prop-2-enoate |
|---|---|
| PubChem CID | 121324124 |
| Molecular Formula | C15H24O6 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | [2-ethyl-5-methylperoxy-2-(prop-2-enoyloxymethyl)pentyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(CC)(CCCOOC)COC(=O)C=C |
| InChI | InChI=1S/C15H24O6/c1-5-13(16)19-11-15(7-3,9-8-10-21-18-4)12-20-14(17)6-2/h5-6H,1-2,7-12H2,3-4H3 |
| InChIKey | QVPAZNZIXVGOTR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|