C28H35NO8 — CID 121338155
6-[[(4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxycarbonyloxy]-2-methylhexanoic acid (PubChem CID 121338155) has the molecular formula C28H35NO8 and a molecular weight of 513.59 g/mol. Its IUPAC name is 6-[[(4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxycarbonyloxy]-2-methylhexanoic acid.
| Compound Name | 6-[[(4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxycarbonyloxy]-2-methylhexanoic acid |
|---|---|
| PubChem CID | 121338155 |
| Molecular Formula | C28H35NO8 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | 6-[[(4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxycarbonyloxy]-2-methylhexanoic acid |
| SMILES | CC(CCCCOC(=O)OC1=CC[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3CC2CC2)[C@H]1O5)C(=O)O |
| InChI | InChI=1S/C28H35NO8/c1-16(25(31)32)4-2-3-13-35-26(33)36-20-9-10-28(34)21-14-18-7-8-19(30)23-22(18)27(28,24(20)37-23)11-12-29(21)15-17-5-6-17/h7-9,16-17,21,24,30,34H,2-6,10-15H2,1H3,(H,31,32)/t16?,21-,24+,27+,28-/m1/s1 |
| InChIKey | ZMMLINDIYHZLNT-PTHXBNFMSA-N |
| XLogP | 3.49 |
| TPSA | 125.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|