C23H27F4N3O2S — CID 121380192
[4-[[ethyl(methyl)amino]methylideneamino]-2,5-dimethylphenyl] (2S)-2-amino-3-[3-(1,1,2,2-tetrafluoroethylsulfanyl)phenyl]propanoate (PubChem CID 121380192) has the molecular formula C23H27F4N3O2S and a molecular weight of 485.55 g/mol. Its IUPAC name is [4-[[ethyl(methyl)amino]methylideneamino]-2,5-dimethylphenyl] (2S)-2-amino-3-[3-(1,1,2,2-tetrafluoroethylsulfanyl)phenyl]propanoate.
| Compound Name | [4-[[ethyl(methyl)amino]methylideneamino]-2,5-dimethylphenyl] (2S)-2-amino-3-[3-(1,1,2,2-tetrafluoroethylsulfanyl)phenyl]propanoate |
|---|---|
| PubChem CID | 121380192 |
| Molecular Formula | C23H27F4N3O2S |
| Molecular Weight | 485.55 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | [4-[[ethyl(methyl)amino]methylideneamino]-2,5-dimethylphenyl] (2S)-2-amino-3-[3-(1,1,2,2-tetrafluoroethylsulfanyl)phenyl]propanoate |
| SMILES | CCN(C)/C=N/c1cc(C)c(OC(=O)[C@@H](N)Cc2cccc(SC(F)(F)C(F)F)c2)cc1C |
| InChI | InChI=1S/C23H27F4N3O2S/c1-5-30(4)13-29-19-9-15(3)20(10-14(19)2)32-21(31)18(28)12-16-7-6-8-17(11-16)33-23(26,27)22(24)25/h6-11,13,18,22H,5,12,28H2,1-4H3/b29-13+/t18-/m0/s1 |
| InChIKey | GDDSEEWOUATHHR-XESQOAJGSA-N |
| XLogP | 5.34 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|