C7H11NO3 — CID 121410304
[(1S,2S,3S,5S)-2-hydroxy-3-bicyclo[3.1.0]hexanyl] carbamate (PubChem CID 121410304) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is [(1S,2S,3S,5S)-2-hydroxy-3-bicyclo[3.1.0]hexanyl] carbamate.
| Compound Name | [(1S,2S,3S,5S)-2-hydroxy-3-bicyclo[3.1.0]hexanyl] carbamate |
|---|---|
| PubChem CID | 121410304 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | [(1S,2S,3S,5S)-2-hydroxy-3-bicyclo[3.1.0]hexanyl] carbamate |
| SMILES | NC(=O)O[C@H]1C[C@@H]2C[C@@H]2[C@@H]1O |
| InChI | InChI=1S/C7H11NO3/c8-7(10)11-5-2-3-1-4(3)6(5)9/h3-6,9H,1-2H2,(H2,8,10)/t3-,4-,5-,6-/m0/s1 |
| InChIKey | MXEQXKUGWDBXPE-BXKVDMCESA-N |
| XLogP | -0.15 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |