C7H11NO3 — CID 118036175
[(3S,5S)-2-hydroxy-3-bicyclo[3.1.0]hexanyl]carbamic acid (PubChem CID 118036175) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is [(3S,5S)-2-hydroxy-3-bicyclo[3.1.0]hexanyl]carbamic acid.
| Compound Name | [(3S,5S)-2-hydroxy-3-bicyclo[3.1.0]hexanyl]carbamic acid |
|---|---|
| PubChem CID | 118036175 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | [(3S,5S)-2-hydroxy-3-bicyclo[3.1.0]hexanyl]carbamic acid |
| SMILES | O=C(O)N[C@H]1C[C@@H]2CC2C1O |
| InChI | InChI=1S/C7H11NO3/c9-6-4-1-3(4)2-5(6)8-7(10)11/h3-6,8-9H,1-2H2,(H,10,11)/t3-,4?,5-,6?/m0/s1 |
| InChIKey | ZLOSJTVWVXPNKC-RHAWHZQYSA-N |
| XLogP | 0.02 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |