[(3S,5S)-2-hydroxy-3-bicyclo[3.1.0]hexanyl]carbamic acid

C7H11NO3 — CID 118036175

IUPAC[(3S,5S)-2-hydroxy-3-bicyclo[3.1.0]hexanyl]carbamic acid
SMILESO=C(O)N[C@H]1C[C@@H]2CC2C1O
InChIInChI=1S/C7H11NO3/c9-6-4-1-3(4)2-5(6)8-7(10)11/h3-6,8-9H,1-2H2,(H,10,11)/t3-,4?,5-,6?/m0/s1
InChIKeyZLOSJTVWVXPNKC-RHAWHZQYSA-N
MW157.17 g/mol
LogP0.02
Rot. Bonds1

About [(3S,5S)-2-hydroxy-3-bicyclo[3.1.0]hexanyl]carbamic acid

[(3S,5S)-2-hydroxy-3-bicyclo[3.1.0]hexanyl]carbamic acid (PubChem CID 118036175) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is [(3S,5S)-2-hydroxy-3-bicyclo[3.1.0]hexanyl]carbamic acid.

Molecular Properties

Compound Name[(3S,5S)-2-hydroxy-3-bicyclo[3.1.0]hexanyl]carbamic acid
PubChem CID118036175
Molecular FormulaC7H11NO3
Molecular Weight157.17 g/mol
Exact Mass157.07
IUPAC Name[(3S,5S)-2-hydroxy-3-bicyclo[3.1.0]hexanyl]carbamic acid
SMILESO=C(O)N[C@H]1C[C@@H]2CC2C1O
InChIInChI=1S/C7H11NO3/c9-6-4-1-3(4)2-5(6)8-7(10)11/h3-6,8-9H,1-2H2,(H,10,11)/t3-,4?,5-,6?/m0/s1
InChIKeyZLOSJTVWVXPNKC-RHAWHZQYSA-N
XLogP0.02
TPSA69.56 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500157.17
LogP ≤ 50.02
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze [(3S,5S)-2-hydroxy-3-bicyclo[3.1.0]hexanyl]carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(3S,5S)-2-hydroxy-3-bicyclo[3.1.0]hexanyl]carbamic acid?
The IUPAC name of [(3S,5S)-2-hydroxy-3-bicyclo[3.1.0]hexanyl]carbamic acid (CID 118036175) is [(3S,5S)-2-hydroxy-3-bicyclo[3.1.0]hexanyl]carbamic acid.
What is the SMILES notation for [(3S,5S)-2-hydroxy-3-bicyclo[3.1.0]hexanyl]carbamic acid?
The canonical SMILES for [(3S,5S)-2-hydroxy-3-bicyclo[3.1.0]hexanyl]carbamic acid is O=C(O)N[C@H]1C[C@@H]2CC2C1O.
What is the InChIKey of [(3S,5S)-2-hydroxy-3-bicyclo[3.1.0]hexanyl]carbamic acid?
The InChIKey is ZLOSJTVWVXPNKC-RHAWHZQYSA-N. The full InChI is InChI=1S/C7H11NO3/c9-6-4-1-3(4)2-5(6)8-7(10)11/h3-6,8-9H,1-2H2,(H,10,11)/t3-,4?,5-,6?/m0/s1.
What are the key properties of [(3S,5S)-2-hydroxy-3-bicyclo[3.1.0]hexanyl]carbamic acid?
[(3S,5S)-2-hydroxy-3-bicyclo[3.1.0]hexanyl]carbamic acid has a molecular weight of 157.17 g/mol, XLogP of 0.02, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,5S)-2-hydroxy-3-bicyclo[3.1.0]hexanyl]carbamic acid is sourced from PubChem (CID 118036175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).