C7H10N2O3 — CID 126623804
[(2R,4R)-4-cyano-2-hydroxycyclopentyl]carbamic acid (PubChem CID 126623804) has the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. Its IUPAC name is [(2R,4R)-4-cyano-2-hydroxycyclopentyl]carbamic acid.
| Compound Name | [(2R,4R)-4-cyano-2-hydroxycyclopentyl]carbamic acid |
|---|---|
| PubChem CID | 126623804 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | [(2R,4R)-4-cyano-2-hydroxycyclopentyl]carbamic acid |
| SMILES | N#C[C@@H]1CC(NC(=O)O)[C@H](O)C1 |
| InChI | InChI=1S/C7H10N2O3/c8-3-4-1-5(6(10)2-4)9-7(11)12/h4-6,9-10H,1-2H2,(H,11,12)/t4-,5?,6-/m1/s1 |
| InChIKey | GBQSGPRBDKHBGY-SPWIIUKKSA-N |
| XLogP | -0.08 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |