C9H9BrFN3 — CID 121451396
4-bromo-5-fluoro-1,3-dihydroisoindole-2-carboximidamide (PubChem CID 121451396) has the molecular formula C9H9BrFN3 and a molecular weight of 258.09 g/mol. Its IUPAC name is 4-bromo-5-fluoro-1,3-dihydroisoindole-2-carboximidamide.
| Compound Name | 4-bromo-5-fluoro-1,3-dihydroisoindole-2-carboximidamide |
|---|---|
| PubChem CID | 121451396 |
| Molecular Formula | C9H9BrFN3 |
| Molecular Weight | 258.09 g/mol |
| Exact Mass | 257.00 |
| IUPAC Name | 4-bromo-5-fluoro-1,3-dihydroisoindole-2-carboximidamide |
| SMILES | [H]/N=C(\N)N1Cc2ccc(F)c(Br)c2C1 |
| InChI | InChI=1S/C9H9BrFN3/c10-8-6-4-14(9(12)13)3-5(6)1-2-7(8)11/h1-2H,3-4H2,(H3,12,13) |
| InChIKey | UGWAUTKAMCRLLU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.09 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|