About zinc bis(2-oxoniobenzoate)
zinc bis(2-oxoniobenzoate) (PubChem CID 122130224) has the molecular formula C14H12O6Zn+2
and a molecular weight of 341.63 g/mol. Its IUPAC name is zinc bis(2-oxoniobenzoate).
Molecular Properties
| Compound Name | zinc bis(2-oxoniobenzoate) |
| PubChem CID | 122130224 |
| Molecular Formula | C14H12O6Zn+2 |
| Molecular Weight | 341.63 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | zinc bis(2-oxoniobenzoate) |
| SMILES | O=C([O-])c1ccccc1[OH2+].O=C([O-])c1ccccc1[OH2+].[Zn+2] |
| InChI | InChI=1S/2C7H6O3.Zn/c2*8-6-4-2-1-3-5(6)7(9)10;/h2*1-4,8H,(H,9,10);/q;;+2 |
| InChIKey | PZXFWBWBWODQCS-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 126.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.63 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc bis(2-oxoniobenzoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc bis(2-oxoniobenzoate)?
The IUPAC name of zinc bis(2-oxoniobenzoate) (CID 122130224) is zinc bis(2-oxoniobenzoate).
What is the SMILES notation for zinc bis(2-oxoniobenzoate)?
The canonical SMILES for zinc bis(2-oxoniobenzoate) is O=C([O-])c1ccccc1[OH2+].O=C([O-])c1ccccc1[OH2+].[Zn+2].
What is the InChIKey of zinc bis(2-oxoniobenzoate)?
The InChIKey is PZXFWBWBWODQCS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H6O3.Zn/c2*8-6-4-2-1-3-5(6)7(9)10;/h2*1-4,8H,(H,9,10);/q;;+2.
What are the key properties of zinc bis(2-oxoniobenzoate)?
zinc bis(2-oxoniobenzoate) has a molecular weight of 341.63 g/mol, XLogP of -1.03, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for zinc bis(2-oxoniobenzoate) is sourced from PubChem (CID 122130224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).