C32H33N5O3 — CID 122194018
(2S)-2-[[2-(2,3-dihydro-1H-inden-5-yloxy)-9-(2-phenylmethoxyethyl)purin-6-yl]amino]-3-phenylpropan-1-ol (PubChem CID 122194018) has the molecular formula C32H33N5O3 and a molecular weight of 535.65 g/mol. Its IUPAC name is (2S)-2-[[2-(2,3-dihydro-1H-inden-5-yloxy)-9-(2-phenylmethoxyethyl)purin-6-yl]amino]-3-phenylpropan-1-ol.
| Compound Name | (2S)-2-[[2-(2,3-dihydro-1H-inden-5-yloxy)-9-(2-phenylmethoxyethyl)purin-6-yl]amino]-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 122194018 |
| Molecular Formula | C32H33N5O3 |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | (2S)-2-[[2-(2,3-dihydro-1H-inden-5-yloxy)-9-(2-phenylmethoxyethyl)purin-6-yl]amino]-3-phenylpropan-1-ol |
| SMILES | OC[C@H](Cc1ccccc1)Nc1nc(Oc2ccc3c(c2)CCC3)nc2c1ncn2CCOCc1ccccc1 |
| InChI | InChI=1S/C32H33N5O3/c38-20-27(18-23-8-3-1-4-9-23)34-30-29-31(37(22-33-29)16-17-39-21-24-10-5-2-6-11-24)36-32(35-30)40-28-15-14-25-12-7-13-26(25)19-28/h1-6,8-11,14-15,19,22,27,38H,7,12-13,16-18,20-21H2,(H,34,35,36)/t27-/m0/s1 |
| InChIKey | JTDFIJZLWVQBGC-MHZLTWQESA-N |
| XLogP | 5.34 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|