C29H26N2O5S — CID 122195328
5-hydroxy-2-phenyl-7-[4-[(6-propanoyl-1,3-benzothiazol-2-yl)amino]butoxy]chromen-4-one (PubChem CID 122195328) has the molecular formula C29H26N2O5S and a molecular weight of 514.60 g/mol. Its IUPAC name is 5-hydroxy-2-phenyl-7-[4-[(6-propanoyl-1,3-benzothiazol-2-yl)amino]butoxy]chromen-4-one.
| Compound Name | 5-hydroxy-2-phenyl-7-[4-[(6-propanoyl-1,3-benzothiazol-2-yl)amino]butoxy]chromen-4-one |
|---|---|
| PubChem CID | 122195328 |
| Molecular Formula | C29H26N2O5S |
| Molecular Weight | 514.60 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | 5-hydroxy-2-phenyl-7-[4-[(6-propanoyl-1,3-benzothiazol-2-yl)amino]butoxy]chromen-4-one |
| SMILES | CCC(=O)c1ccc2nc(NCCCCOc3cc(O)c4c(=O)cc(-c5ccccc5)oc4c3)sc2c1 |
| InChI | InChI=1S/C29H26N2O5S/c1-2-22(32)19-10-11-21-27(14-19)37-29(31-21)30-12-6-7-13-35-20-15-23(33)28-24(34)17-25(36-26(28)16-20)18-8-4-3-5-9-18/h3-5,8-11,14-17,33H,2,6-7,12-13H2,1H3,(H,30,31) |
| InChIKey | SWYBHECUEYWLHF-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.60 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|