C26H31BN2O4 — CID 122216316
tert-butyl 4-cyano-3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]carbazole-9-carboxylate (PubChem CID 122216316) has the molecular formula C26H31BN2O4 and a molecular weight of 446.36 g/mol. Its IUPAC name is tert-butyl 4-cyano-3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]carbazole-9-carboxylate.
| Compound Name | tert-butyl 4-cyano-3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]carbazole-9-carboxylate |
|---|---|
| PubChem CID | 122216316 |
| Molecular Formula | C26H31BN2O4 |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | tert-butyl 4-cyano-3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]carbazole-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c2ccccc2c2c(C#N)c(CCB3OC(C)(C)C(C)(C)O3)ccc21 |
| InChI | InChI=1S/C26H31BN2O4/c1-24(2,3)31-23(30)29-20-11-9-8-10-18(20)22-19(16-28)17(12-13-21(22)29)14-15-27-32-25(4,5)26(6,7)33-27/h8-13H,14-15H2,1-7H3 |
| InChIKey | VDMJUUPHNRKYJI-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 73.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|