C13H12N4O2 — CID 122217008
10-ethyl-6-methylbenzo[g]pteridine-2,4-dione (PubChem CID 122217008) has the molecular formula C13H12N4O2 and a molecular weight of 256.26 g/mol. Its IUPAC name is 10-ethyl-6-methylbenzo[g]pteridine-2,4-dione.
| Compound Name | 10-ethyl-6-methylbenzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 122217008 |
| Molecular Formula | C13H12N4O2 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 10-ethyl-6-methylbenzo[g]pteridine-2,4-dione |
| SMILES | CCn1c2nc(=O)[nH]c(=O)c-2nc2c(C)cccc21 |
| InChI | InChI=1S/C13H12N4O2/c1-3-17-8-6-4-5-7(2)9(8)14-10-11(17)15-13(19)16-12(10)18/h4-6H,3H2,1-2H3,(H,16,18,19) |
| InChIKey | QOATWVVSUOUZTI-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|