C23H23N5O2 — CID 88988464
10-[2-(2,3-dihydro-1H-inden-2-ylamino)ethyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione (PubChem CID 88988464) has the molecular formula C23H23N5O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is 10-[2-(2,3-dihydro-1H-inden-2-ylamino)ethyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione.
| Compound Name | 10-[2-(2,3-dihydro-1H-inden-2-ylamino)ethyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 88988464 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 10-[2-(2,3-dihydro-1H-inden-2-ylamino)ethyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CCNC3Cc4ccccc4C3)c2cc1C |
| InChI | InChI=1S/C23H23N5O2/c1-13-9-18-19(10-14(13)2)28(21-20(25-18)22(29)27-23(30)26-21)8-7-24-17-11-15-5-3-4-6-16(15)12-17/h3-6,9-10,17,24H,7-8,11-12H2,1-2H3,(H,27,29,30) |
| InChIKey | FFMCEAQCFMDSQW-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|