C22H23N5O3 — CID 50907637
10-[2-[(2-methoxyphenyl)methylamino]ethyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione (PubChem CID 50907637) has the molecular formula C22H23N5O3 and a molecular weight of 405.46 g/mol. Its IUPAC name is 10-[2-[(2-methoxyphenyl)methylamino]ethyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione.
| Compound Name | 10-[2-[(2-methoxyphenyl)methylamino]ethyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 50907637 |
| Molecular Formula | C22H23N5O3 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 10-[2-[(2-methoxyphenyl)methylamino]ethyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione |
| SMILES | COc1ccccc1CNCCn1c2nc(=O)[nH]c(=O)c-2nc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C22H23N5O3/c1-13-10-16-17(11-14(13)2)27(20-19(24-16)21(28)26-22(29)25-20)9-8-23-12-15-6-4-5-7-18(15)30-3/h4-7,10-11,23H,8-9,12H2,1-3H3,(H,26,28,29) |
| InChIKey | NDXOABBUSMOJRP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|