C20H23N5O4 — CID 163837345
1-[2-[2-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)ethylamino]ethyl]cyclopropane-1-carboxylic acid (PubChem CID 163837345) has the molecular formula C20H23N5O4 and a molecular weight of 397.44 g/mol. Its IUPAC name is 1-[2-[2-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)ethylamino]ethyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[2-[2-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)ethylamino]ethyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 163837345 |
| Molecular Formula | C20H23N5O4 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 1-[2-[2-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)ethylamino]ethyl]cyclopropane-1-carboxylic acid |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CCNCCC3(C(=O)O)CC3)c2cc1C |
| InChI | InChI=1S/C20H23N5O4/c1-11-9-13-14(10-12(11)2)25(16-15(22-13)17(26)24-19(29)23-16)8-7-21-6-5-20(3-4-20)18(27)28/h9-10,21H,3-8H2,1-2H3,(H,27,28)(H,24,26,29) |
| InChIKey | OIXOIPDDSPGIPV-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|