C15H12O3S2 — CID 122229466
3-(1,3-dithiolan-2-ylidene)-6,8-dimethylnaphthalene-1,2,4-trione (PubChem CID 122229466) has the molecular formula C15H12O3S2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 3-(1,3-dithiolan-2-ylidene)-6,8-dimethylnaphthalene-1,2,4-trione.
| Compound Name | 3-(1,3-dithiolan-2-ylidene)-6,8-dimethylnaphthalene-1,2,4-trione |
|---|---|
| PubChem CID | 122229466 |
| Molecular Formula | C15H12O3S2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 3-(1,3-dithiolan-2-ylidene)-6,8-dimethylnaphthalene-1,2,4-trione |
| SMILES | Cc1cc(C)c2c(c1)C(=O)C(=C1SCCS1)C(=O)C2=O |
| InChI | InChI=1S/C15H12O3S2/c1-7-5-8(2)10-9(6-7)12(16)11(14(18)13(10)17)15-19-3-4-20-15/h5-6H,3-4H2,1-2H3 |
| InChIKey | OYOKWISLEIMHPK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|