C26H27Cl2P — CID 15438629
dichloromethylidene-[4-methyl-2,6-bis(2,4,6-trimethylphenyl)phenyl]phosphane (PubChem CID 15438629) has the molecular formula C26H27Cl2P and a molecular weight of 441.38 g/mol. Its IUPAC name is dichloromethylidene-[4-methyl-2,6-bis(2,4,6-trimethylphenyl)phenyl]phosphane.
| Compound Name | dichloromethylidene-[4-methyl-2,6-bis(2,4,6-trimethylphenyl)phenyl]phosphane |
|---|---|
| PubChem CID | 15438629 |
| Molecular Formula | C26H27Cl2P |
| Molecular Weight | 441.38 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | dichloromethylidene-[4-methyl-2,6-bis(2,4,6-trimethylphenyl)phenyl]phosphane |
| SMILES | Cc1cc(C)c(-c2cc(C)cc(-c3c(C)cc(C)cc3C)c2P=C(Cl)Cl)c(C)c1 |
| InChI | InChI=1S/C26H27Cl2P/c1-14-8-17(4)23(18(5)9-14)21-12-16(3)13-22(25(21)29-26(27)28)24-19(6)10-15(2)11-20(24)7/h8-13H,1-7H3 |
| InChIKey | NVEAMURTNKWEKK-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.38 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|