C22H28P2 — CID 101172290
(2,4,6-trimethylphenyl)-[3-(2,4,6-trimethylphenyl)phosphanylidenebutan-2-ylidene]phosphane (PubChem CID 101172290) has the molecular formula C22H28P2 and a molecular weight of 354.41 g/mol. Its IUPAC name is (2,4,6-trimethylphenyl)-[3-(2,4,6-trimethylphenyl)phosphanylidenebutan-2-ylidene]phosphane.
| Compound Name | (2,4,6-trimethylphenyl)-[3-(2,4,6-trimethylphenyl)phosphanylidenebutan-2-ylidene]phosphane |
|---|---|
| PubChem CID | 101172290 |
| Molecular Formula | C22H28P2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (2,4,6-trimethylphenyl)-[3-(2,4,6-trimethylphenyl)phosphanylidenebutan-2-ylidene]phosphane |
| SMILES | CC(=P\c1c(C)cc(C)cc1C)/C(C)=P/c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C22H28P2/c1-13-9-15(3)21(16(4)10-13)23-19(7)20(8)24-22-17(5)11-14(2)12-18(22)6/h9-12H,1-8H3 |
| InChIKey | APHYJKXIILGGLP-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|