C14H23N2P — CID 12871497
N,N,N',N'-tetramethyl-1-(2,4,6-trimethylphenyl)phosphanylidenemethanediamine (PubChem CID 12871497) has the molecular formula C14H23N2P and a molecular weight of 250.33 g/mol. Its IUPAC name is N,N,N',N'-tetramethyl-1-(2,4,6-trimethylphenyl)phosphanylidenemethanediamine.
| Compound Name | N,N,N',N'-tetramethyl-1-(2,4,6-trimethylphenyl)phosphanylidenemethanediamine |
|---|---|
| PubChem CID | 12871497 |
| Molecular Formula | C14H23N2P |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | N,N,N',N'-tetramethyl-1-(2,4,6-trimethylphenyl)phosphanylidenemethanediamine |
| SMILES | Cc1cc(C)c(P=C(N(C)C)N(C)C)c(C)c1 |
| InChI | InChI=1S/C14H23N2P/c1-10-8-11(2)13(12(3)9-10)17-14(15(4)5)16(6)7/h8-9H,1-7H3 |
| InChIKey | FHVDLYSFVCAFOW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|